C30H36N4O8S4 — CID 145321171
5-[5-(dithiolan-3-yl)pentanoylamino]-4-hydroxy-7-methoxysulfonyl-3-[(4-piperidin-1-ylphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 145321171) has the molecular formula C30H36N4O8S4 and a molecular weight of 708.91 g/mol. Its IUPAC name is 5-[5-(dithiolan-3-yl)pentanoylamino]-4-hydroxy-7-methoxysulfonyl-3-[(4-piperidin-1-ylphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 5-[5-(dithiolan-3-yl)pentanoylamino]-4-hydroxy-7-methoxysulfonyl-3-[(4-piperidin-1-ylphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 145321171 |
| Molecular Formula | C30H36N4O8S4 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.14 |
| IUPAC Name | 5-[5-(dithiolan-3-yl)pentanoylamino]-4-hydroxy-7-methoxysulfonyl-3-[(4-piperidin-1-ylphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COS(=O)(=O)c1cc(NC(=O)CCCCC2CCSS2)c2c(O)c(/N=N/c3ccc(N4CCCCC4)cc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C30H36N4O8S4/c1-42-46(40,41)24-17-20-18-26(45(37,38)39)29(33-32-21-9-11-22(12-10-21)34-14-5-2-6-15-34)30(36)28(20)25(19-24)31-27(35)8-4-3-7-23-13-16-43-44-23/h9-12,17-19,23,36H,2-8,13-16H2,1H3,(H,31,35)(H,37,38,39)/b33-32+ |
| InChIKey | TUHCLSIXVGNFPO-ULIFNZDWSA-N |
| XLogP | 7.19 |
| TPSA | 175.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|