C20H23NO3S2 — CID 163240759
N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide (PubChem CID 163240759) has the molecular formula C20H23NO3S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide.
| Compound Name | N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 163240759 |
| Molecular Formula | C20H23NO3S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide |
| SMILES | Cc1cc2c(cc1C)C(=O)C(NC(=O)CCCC[C@@H]1CCSS1)=CC2=O |
| InChI | InChI=1S/C20H23NO3S2/c1-12-9-15-16(10-13(12)2)20(24)17(11-18(15)22)21-19(23)6-4-3-5-14-7-8-25-26-14/h9-11,14H,3-8H2,1-2H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | ZVRTYZAQHWMBKQ-CQSZACIVSA-N |
| XLogP | 4.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|