About N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide
N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide (PubChem CID 163240759) has the molecular formula C20H23NO3S2
and a molecular weight of 389.54 g/mol. Its IUPAC name is N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide.
Molecular Properties
| Compound Name | N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide |
| PubChem CID | 163240759 |
| Molecular Formula | C20H23NO3S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide |
| SMILES | Cc1cc2c(cc1C)C(=O)C(NC(=O)CCCC[C@@H]1CCSS1)=CC2=O |
| InChI | InChI=1S/C20H23NO3S2/c1-12-9-15-16(10-13(12)2)20(24)17(11-18(15)22)21-19(23)6-4-3-5-14-7-8-25-26-14/h9-11,14H,3-8H2,1-2H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | ZVRTYZAQHWMBKQ-CQSZACIVSA-N |
| XLogP | 4.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide?
The IUPAC name of N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide (CID 163240759) is N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide.
What is the SMILES notation for N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide?
The canonical SMILES for N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide is Cc1cc2c(cc1C)C(=O)C(NC(=O)CCCC[C@@H]1CCSS1)=CC2=O.
What is the InChIKey of N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide?
The InChIKey is ZVRTYZAQHWMBKQ-CQSZACIVSA-N. The full InChI is InChI=1S/C20H23NO3S2/c1-12-9-15-16(10-13(12)2)20(24)17(11-18(15)22)21-19(23)6-4-3-5-14-7-8-25-26-14/h9-11,14H,3-8H2,1-2H3,(H,21,23)/t14-/m1/s1.
What are the key properties of N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide?
N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide has a molecular weight of 389.54 g/mol, XLogP of 4.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6,7-dimethyl-1,4-dioxonaphthalen-2-yl)-5-[(3R)-dithiolan-3-yl]pentanamide is sourced from PubChem (CID 163240759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).