C12H18N2OS3 — CID 24645329
5-(dithiolan-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 24645329) has the molecular formula C12H18N2OS3 and a molecular weight of 302.49 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 24645329 |
| Molecular Formula | C12H18N2OS3 |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-(4-methyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | Cc1csc(NC(=O)CCCCC2CCSS2)n1 |
| InChI | InChI=1S/C12H18N2OS3/c1-9-8-16-12(13-9)14-11(15)5-3-2-4-10-6-7-17-18-10/h8,10H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | ILNZXIVFIHOJCY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|