C14H20N4O2S2 — CID 52716207
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 52716207) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 52716207 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-methyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | Cc1csc(NC(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)n1 |
| InChI | InChI=1S/C14H20N4O2S2/c1-8-6-22-14(15-8)17-11(19)5-3-2-4-10-12-9(7-21-10)16-13(20)18-12/h6,9-10,12H,2-5,7H2,1H3,(H,15,17,19)(H2,16,18,20)/t9-,10-,12-/m0/s1 |
| InChIKey | KHAJONDSQMHQJV-NHCYSSNCSA-N |
| XLogP | 2.12 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|