C16H22N4O2S2 — CID 95397490
5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)pentanamide (PubChem CID 95397490) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)pentanamide.
| Compound Name | 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 95397490 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)pentanamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@H]2NC(=O)N[C@@H]12)Nc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C16H22N4O2S2/c21-13(19-16-18-9-4-3-6-11(9)24-16)7-2-1-5-12-14-10(8-23-12)17-15(22)20-14/h10,12,14H,1-8H2,(H2,17,20,22)(H,18,19,21)/t10-,12+,14-/m1/s1 |
| InChIKey | HRSZTWCKLCABTG-SCDSUCTJSA-N |
| XLogP | 2.30 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|