C18H21N5O2S2 — CID 71753569
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pentanamide (PubChem CID 71753569) has the molecular formula C18H21N5O2S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 71753569 |
| Molecular Formula | C18H21N5O2S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)pentanamide |
| SMILES | O=C(CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C18H21N5O2S2/c24-15(22-18-21-12(9-27-18)11-4-3-7-19-8-11)6-2-1-5-14-16-13(10-26-14)20-17(25)23-16/h3-4,7-9,13-14,16H,1-2,5-6,10H2,(H2,20,23,25)(H,21,22,24)/t13-,14-,16-/m0/s1 |
| InChIKey | ARPOIBVDIYNDPF-DZKIICNBSA-N |
| XLogP | 2.87 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|