C16H19N3OS3 — CID 35875492
5-[(3S)-dithiolan-3-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentanamide (PubChem CID 35875492) has the molecular formula C16H19N3OS3 and a molecular weight of 365.55 g/mol. Its IUPAC name is 5-[(3S)-dithiolan-3-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | 5-[(3S)-dithiolan-3-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 35875492 |
| Molecular Formula | C16H19N3OS3 |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 5-[(3S)-dithiolan-3-yl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentanamide |
| SMILES | O=C(CCCC[C@H]1CCSS1)Nc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C16H19N3OS3/c20-15(7-2-1-5-12-8-10-22-23-12)19-16-18-14(11-21-16)13-6-3-4-9-17-13/h3-4,6,9,11-12H,1-2,5,7-8,10H2,(H,18,19,20)/t12-/m0/s1 |
| InChIKey | ALYQPWVJXVHBMF-LBPRGKRZSA-N |
| XLogP | 4.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|