C15H18N2OS3 — CID 24644798
N-(1,3-benzothiazol-2-yl)-5-(dithiolan-3-yl)pentanamide (PubChem CID 24644798) has the molecular formula C15H18N2OS3 and a molecular weight of 338.52 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 24644798 |
| Molecular Formula | C15H18N2OS3 |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-(dithiolan-3-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H18N2OS3/c18-14(8-4-1-5-11-9-10-19-21-11)17-15-16-12-6-2-3-7-13(12)20-15/h2-3,6-7,11H,1,4-5,8-10H2,(H,16,17,18) |
| InChIKey | ZVSOPSBKGUOHHA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|