C12H14N2O2S — CID 79198900
N-(1,3-benzothiazol-2-yl)-5-hydroxypentanamide (PubChem CID 79198900) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-hydroxypentanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-hydroxypentanamide |
|---|---|
| PubChem CID | 79198900 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-hydroxypentanamide |
| SMILES | O=C(CCCCO)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14N2O2S/c15-8-4-3-7-11(16)14-12-13-9-5-1-2-6-10(9)17-12/h1-2,5-6,15H,3-4,7-8H2,(H,13,14,16) |
| InChIKey | SIKFEACQHHLSJD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|