C14H14N2O3S — CID 2304671
prop-2-enyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate (PubChem CID 2304671) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is prop-2-enyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate.
| Compound Name | prop-2-enyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 2304671 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | prop-2-enyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate |
| SMILES | C=CCOC(=O)CCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H14N2O3S/c1-2-9-19-13(18)8-7-12(17)16-14-15-10-5-3-4-6-11(10)20-14/h2-6H,1,7-9H2,(H,15,16,17) |
| InChIKey | DLOUMQHIYNHFTC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|