C17H15BrN2O2S — CID 2677009
N-(1,3-benzothiazol-2-yl)-4-(3-bromophenoxy)butanamide (PubChem CID 2677009) has the molecular formula C17H15BrN2O2S and a molecular weight of 391.29 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(3-bromophenoxy)butanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(3-bromophenoxy)butanamide |
|---|---|
| PubChem CID | 2677009 |
| Molecular Formula | C17H15BrN2O2S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(3-bromophenoxy)butanamide |
| SMILES | O=C(CCCOc1cccc(Br)c1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H15BrN2O2S/c18-12-5-3-6-13(11-12)22-10-4-9-16(21)20-17-19-14-7-1-2-8-15(14)23-17/h1-3,5-8,11H,4,9-10H2,(H,19,20,21) |
| InChIKey | HVGIEBWGKSCIEL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|