C14H20N2OSSi — CID 53439401
N-(1,3-benzothiazol-2-yl)-4-trimethylsilylbutanamide (PubChem CID 53439401) has the molecular formula C14H20N2OSSi and a molecular weight of 292.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-trimethylsilylbutanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-trimethylsilylbutanamide |
|---|---|
| PubChem CID | 53439401 |
| Molecular Formula | C14H20N2OSSi |
| Molecular Weight | 292.48 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-trimethylsilylbutanamide |
| SMILES | C[Si](C)(C)CCCC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H20N2OSSi/c1-19(2,3)10-6-9-13(17)16-14-15-11-7-4-5-8-12(11)18-14/h4-5,7-8H,6,9-10H2,1-3H3,(H,15,16,17) |
| InChIKey | FACHEPVVRSSCBS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|