C14H12F4N2O3S — CID 2245386
2,2,3,3-tetrafluoropropyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate (PubChem CID 2245386) has the molecular formula C14H12F4N2O3S and a molecular weight of 364.32 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 2245386 |
| Molecular Formula | C14H12F4N2O3S |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 4-(1,3-benzothiazol-2-ylamino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(F)(F)C(F)F)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H12F4N2O3S/c15-12(16)14(17,18)7-23-11(22)6-5-10(21)20-13-19-8-3-1-2-4-9(8)24-13/h1-4,12H,5-7H2,(H,19,20,21) |
| InChIKey | KDQGKMDIYNOLGP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|