C16H15N3OS — CID 61037275
3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)propanamide (PubChem CID 61037275) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 61037275 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(4-aminophenyl)-N-(1,3-benzothiazol-2-yl)propanamide |
| SMILES | Nc1ccc(CCC(=O)Nc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C16H15N3OS/c17-12-8-5-11(6-9-12)7-10-15(20)19-16-18-13-3-1-2-4-14(13)21-16/h1-6,8-9H,7,10,17H2,(H,18,19,20) |
| InChIKey | FXKMJBJACNXHFK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|