C19H15N3OS — CID 43064333
N-(1,3-benzothiazol-2-yl)-2-(4-pyrrol-1-ylphenyl)acetamide (PubChem CID 43064333) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(4-pyrrol-1-ylphenyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(4-pyrrol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 43064333 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(4-pyrrol-1-ylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-n2cccc2)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15N3OS/c23-18(21-19-20-16-5-1-2-6-17(16)24-19)13-14-7-9-15(10-8-14)22-11-3-4-12-22/h1-12H,13H2,(H,20,21,23) |
| InChIKey | WYYHABNDZGEJAI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |