C13H17N3O3S — CID 60686532
N-(1,3-benzothiazol-2-yl)-2-[bis(2-hydroxyethyl)amino]acetamide (PubChem CID 60686532) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[bis(2-hydroxyethyl)amino]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[bis(2-hydroxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 60686532 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[bis(2-hydroxyethyl)amino]acetamide |
| SMILES | O=C(CN(CCO)CCO)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17N3O3S/c17-7-5-16(6-8-18)9-12(19)15-13-14-10-3-1-2-4-11(10)20-13/h1-4,17-18H,5-9H2,(H,14,15,19) |
| InChIKey | BVVOXJMWLRAQBY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |