C16H20N4OS2 — CID 166403475
5-(dithiolan-3-yl)-N-(5-pyridin-3-yl-1H-pyrazol-3-yl)pentanamide (PubChem CID 166403475) has the molecular formula C16H20N4OS2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-(5-pyridin-3-yl-1H-pyrazol-3-yl)pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-(5-pyridin-3-yl-1H-pyrazol-3-yl)pentanamide |
|---|---|
| PubChem CID | 166403475 |
| Molecular Formula | C16H20N4OS2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-(5-pyridin-3-yl-1H-pyrazol-3-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1cc(-c2cccnc2)[nH]n1 |
| InChI | InChI=1S/C16H20N4OS2/c21-16(6-2-1-5-13-7-9-22-23-13)18-15-10-14(19-20-15)12-4-3-8-17-11-12/h3-4,8,10-11,13H,1-2,5-7,9H2,(H2,18,19,20,21) |
| InChIKey | SPVIFJRNJAYGIQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|