C18H26N2OS2 — CID 102564574
5-(dithiolan-3-yl)-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]pentan-1-one (PubChem CID 102564574) has the molecular formula C18H26N2OS2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]pentan-1-one.
| Compound Name | 5-(dithiolan-3-yl)-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 102564574 |
| Molecular Formula | C18H26N2OS2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-(dithiolan-3-yl)-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]pentan-1-one |
| SMILES | O=C(CCCCC1CCSS1)N1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C18H26N2OS2/c21-18(9-2-1-7-16-10-13-22-23-16)20-12-4-3-8-17(20)15-6-5-11-19-14-15/h5-6,11,14,16-17H,1-4,7-10,12-13H2/t16?,17-/m0/s1 |
| InChIKey | QXDORHPZRXXIRR-DJNXLDHESA-N |
| XLogP | 4.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|