C19H27N3O2S2 — CID 66558266
5-[(3R)-dithiolan-3-yl]-N-[2-[[(E)-4-pyridin-3-ylbut-3-enoyl]amino]ethyl]pentanamide (PubChem CID 66558266) has the molecular formula C19H27N3O2S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-[2-[[(E)-4-pyridin-3-ylbut-3-enoyl]amino]ethyl]pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-[2-[[(E)-4-pyridin-3-ylbut-3-enoyl]amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 66558266 |
| Molecular Formula | C19H27N3O2S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-[2-[[(E)-4-pyridin-3-ylbut-3-enoyl]amino]ethyl]pentanamide |
| SMILES | O=C(C/C=C/c1cccnc1)NCCNC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C19H27N3O2S2/c23-18(8-2-1-7-17-10-14-25-26-17)21-12-13-22-19(24)9-3-5-16-6-4-11-20-15-16/h3-6,11,15,17H,1-2,7-10,12-14H2,(H,21,23)(H,22,24)/b5-3+/t17-/m1/s1 |
| InChIKey | FBAFNSGOURWPGM-NJELEJDNSA-N |
| XLogP | 3.43 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|