C11H21NO2S2 — CID 96544742
5-[(3S)-dithiolan-3-yl]-N-(3-hydroxypropyl)pentanamide (PubChem CID 96544742) has the molecular formula C11H21NO2S2 and a molecular weight of 263.43 g/mol. Its IUPAC name is 5-[(3S)-dithiolan-3-yl]-N-(3-hydroxypropyl)pentanamide.
| Compound Name | 5-[(3S)-dithiolan-3-yl]-N-(3-hydroxypropyl)pentanamide |
|---|---|
| PubChem CID | 96544742 |
| Molecular Formula | C11H21NO2S2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 5-[(3S)-dithiolan-3-yl]-N-(3-hydroxypropyl)pentanamide |
| SMILES | O=C(CCCC[C@H]1CCSS1)NCCCO |
| InChI | InChI=1S/C11H21NO2S2/c13-8-3-7-12-11(14)5-2-1-4-10-6-9-15-16-10/h10,13H,1-9H2,(H,12,14)/t10-/m0/s1 |
| InChIKey | QPQPASXMSHOHIW-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|