C19H34N2O2S2 — CID 118143890
9-(dithiolan-3-yl)-N-[3-(2-methylprop-2-enoylamino)propyl]nonanamide (PubChem CID 118143890) has the molecular formula C19H34N2O2S2 and a molecular weight of 386.63 g/mol. Its IUPAC name is 9-(dithiolan-3-yl)-N-[3-(2-methylprop-2-enoylamino)propyl]nonanamide.
| Compound Name | 9-(dithiolan-3-yl)-N-[3-(2-methylprop-2-enoylamino)propyl]nonanamide |
|---|---|
| PubChem CID | 118143890 |
| Molecular Formula | C19H34N2O2S2 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 9-(dithiolan-3-yl)-N-[3-(2-methylprop-2-enoylamino)propyl]nonanamide |
| SMILES | C=C(C)C(=O)NCCCNC(=O)CCCCCCCCC1CCSS1 |
| InChI | InChI=1S/C19H34N2O2S2/c1-16(2)19(23)21-14-9-13-20-18(22)11-8-6-4-3-5-7-10-17-12-15-24-25-17/h17H,1,3-15H2,2H3,(H,20,22)(H,21,23) |
| InChIKey | PUAMRHHADIRNQL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|