C18H33NO7S2 — CID 165344082
2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 165344082) has the molecular formula C18H33NO7S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 165344082 |
| Molecular Formula | C18H33NO7S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[2-[2-[2-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCOCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C18H33NO7S2/c20-17(4-2-1-3-16-5-14-27-28-16)19-6-7-23-8-9-24-10-11-25-12-13-26-15-18(21)22/h16H,1-15H2,(H,19,20)(H,21,22) |
| InChIKey | IBRWIGPVHOMUJD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|