C27H48N4O5S4 — CID 161304844
(3S)-N-[2-(2-aminoethoxy)ethyl]-3,7-bis[5-(dithiolan-3-yl)pentanoylamino]-4-oxoheptanamide (PubChem CID 161304844) has the molecular formula C27H48N4O5S4 and a molecular weight of 636.97 g/mol. Its IUPAC name is (3S)-N-[2-(2-aminoethoxy)ethyl]-3,7-bis[5-(dithiolan-3-yl)pentanoylamino]-4-oxoheptanamide.
| Compound Name | (3S)-N-[2-(2-aminoethoxy)ethyl]-3,7-bis[5-(dithiolan-3-yl)pentanoylamino]-4-oxoheptanamide |
|---|---|
| PubChem CID | 161304844 |
| Molecular Formula | C27H48N4O5S4 |
| Molecular Weight | 636.97 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | (3S)-N-[2-(2-aminoethoxy)ethyl]-3,7-bis[5-(dithiolan-3-yl)pentanoylamino]-4-oxoheptanamide |
| SMILES | NCCOCCNC(=O)C[C@H](NC(=O)CCCCC1CCSS1)C(=O)CCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C27H48N4O5S4/c28-13-16-36-17-15-30-27(35)20-23(31-26(34)10-4-2-7-22-12-19-38-40-22)24(32)8-5-14-29-25(33)9-3-1-6-21-11-18-37-39-21/h21-23H,1-20,28H2,(H,29,33)(H,30,35)(H,31,34)/t21?,22?,23-/m0/s1 |
| InChIKey | VICLUKFMPUYUQI-VNXZQDSDSA-N |
| XLogP | 3.85 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|