C12H22N4O2S2 — CID 138655599
N-[2-(2-azidoethoxy)ethyl]-5-(dithiolan-3-yl)pentanamide (PubChem CID 138655599) has the molecular formula C12H22N4O2S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is N-[2-(2-azidoethoxy)ethyl]-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-[2-(2-azidoethoxy)ethyl]-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 138655599 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[2-(2-azidoethoxy)ethyl]-5-(dithiolan-3-yl)pentanamide |
| SMILES | [N-]=[N+]=NCCOCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C12H22N4O2S2/c13-16-15-7-9-18-8-6-14-12(17)4-2-1-3-11-5-10-19-20-11/h11H,1-10H2,(H,14,17) |
| InChIKey | JAHRTAGPWBLTQN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|