C12H22N2O3S2 — CID 87772162
5-(dithiolan-3-yl)-N-[2-[(2-hydroxyacetyl)amino]ethyl]pentanamide (PubChem CID 87772162) has the molecular formula C12H22N2O3S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[2-[(2-hydroxyacetyl)amino]ethyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[2-[(2-hydroxyacetyl)amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 87772162 |
| Molecular Formula | C12H22N2O3S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[2-[(2-hydroxyacetyl)amino]ethyl]pentanamide |
| SMILES | O=C(CO)NCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C12H22N2O3S2/c15-9-12(17)14-7-6-13-11(16)4-2-1-3-10-5-8-18-19-10/h10,15H,1-9H2,(H,13,16)(H,14,17) |
| InChIKey | ZTHYAWKWUFJBHG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|