C17H24N2O5S2 — CID 123566723
N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-3,4,5-trihydroxybenzamide (PubChem CID 123566723) has the molecular formula C17H24N2O5S2 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 123566723 |
| Molecular Formula | C17H24N2O5S2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(CCCCC1CCSS1)NCCNC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C17H24N2O5S2/c20-13-9-11(10-14(21)16(13)23)17(24)19-7-6-18-15(22)4-2-1-3-12-5-8-25-26-12/h9-10,12,20-21,23H,1-8H2,(H,18,22)(H,19,24) |
| InChIKey | AWVGGZSBPSDGOQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|