C20H31N3O3S2 — CID 87273201
N-[3-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]propyl]-2-hydroxybenzamide (PubChem CID 87273201) has the molecular formula C20H31N3O3S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is N-[3-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]propyl]-2-hydroxybenzamide.
| Compound Name | N-[3-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]propyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 87273201 |
| Molecular Formula | C20H31N3O3S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[3-[2-[5-(dithiolan-3-yl)pentanoylamino]ethylamino]propyl]-2-hydroxybenzamide |
| SMILES | O=C(CCCCC1CCSS1)NCCNCCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C20H31N3O3S2/c24-18-8-3-2-7-17(18)20(26)23-12-5-11-21-13-14-22-19(25)9-4-1-6-16-10-15-27-28-16/h2-3,7-8,16,21,24H,1,4-6,9-15H2,(H,22,25)(H,23,26) |
| InChIKey | MKPPKLBPTYCUCB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|