C17H27N2OS2+ — CID 88945486
5-(dithiolan-3-yl)-N-[3-(4-methylpyridin-1-ium-1-yl)propyl]pentanamide (PubChem CID 88945486) has the molecular formula C17H27N2OS2+ and a molecular weight of 339.55 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[3-(4-methylpyridin-1-ium-1-yl)propyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[3-(4-methylpyridin-1-ium-1-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 88945486 |
| Molecular Formula | C17H27N2OS2+ |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[3-(4-methylpyridin-1-ium-1-yl)propyl]pentanamide |
| SMILES | Cc1cc[n+](CCCNC(=O)CCCCC2CCSS2)cc1 |
| InChI | InChI=1S/C17H26N2OS2/c1-15-7-12-19(13-8-15)11-4-10-18-17(20)6-3-2-5-16-9-14-21-22-16/h7-8,12-13,16H,2-6,9-11,14H2,1H3/p+1 |
| InChIKey | QUWWXBRNGJWCNY-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|