C15H19F2NOS2 — CID 97489011
N-[(2,6-difluorophenyl)methyl]-5-[(3S)-dithiolan-3-yl]pentanamide (PubChem CID 97489011) has the molecular formula C15H19F2NOS2 and a molecular weight of 331.45 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-5-[(3S)-dithiolan-3-yl]pentanamide.
| Compound Name | N-[(2,6-difluorophenyl)methyl]-5-[(3S)-dithiolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 97489011 |
| Molecular Formula | C15H19F2NOS2 |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-5-[(3S)-dithiolan-3-yl]pentanamide |
| SMILES | O=C(CCCC[C@H]1CCSS1)NCc1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2NOS2/c16-13-5-3-6-14(17)12(13)10-18-15(19)7-2-1-4-11-8-9-20-21-11/h3,5-6,11H,1-2,4,7-10H2,(H,18,19)/t11-/m0/s1 |
| InChIKey | UPPRSTVSWSKRFU-NSHDSACASA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|