C20H23FN2O2S2 — CID 55859159
5-(dithiolan-3-yl)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]pentanamide (PubChem CID 55859159) has the molecular formula C20H23FN2O2S2 and a molecular weight of 406.55 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]pentanamide |
|---|---|
| PubChem CID | 55859159 |
| Molecular Formula | C20H23FN2O2S2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C20H23FN2O2S2/c21-16-6-8-17(9-7-16)25-20-10-5-15(14-23-20)13-22-19(24)4-2-1-3-18-11-12-26-27-18/h5-10,14,18H,1-4,11-13H2,(H,22,24) |
| InChIKey | XNQHARKWCGAWDR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|