C16H18FN3O2 — CID 119847800
(2S)-2-amino-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]butanamide (PubChem CID 119847800) has the molecular formula C16H18FN3O2 and a molecular weight of 303.34 g/mol. Its IUPAC name is (2S)-2-amino-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]butanamide.
| Compound Name | (2S)-2-amino-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]butanamide |
|---|---|
| PubChem CID | 119847800 |
| Molecular Formula | C16H18FN3O2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2S)-2-amino-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]butanamide |
| SMILES | CC[C@H](N)C(=O)NCc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C16H18FN3O2/c1-2-14(18)16(21)20-10-11-3-8-15(19-9-11)22-13-6-4-12(17)5-7-13/h3-9,14H,2,10,18H2,1H3,(H,20,21)/t14-/m0/s1 |
| InChIKey | PXVLJSKUNOGIKJ-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |