C15H22N2O3S3 — CID 97424666
5-[(3R)-dithiolan-3-yl]-N-[(4-sulfamoylphenyl)methyl]pentanamide (PubChem CID 97424666) has the molecular formula C15H22N2O3S3 and a molecular weight of 374.55 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-[(4-sulfamoylphenyl)methyl]pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-[(4-sulfamoylphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 97424666 |
| Molecular Formula | C15H22N2O3S3 |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-[(4-sulfamoylphenyl)methyl]pentanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CCCC[C@@H]2CCSS2)cc1 |
| InChI | InChI=1S/C15H22N2O3S3/c16-23(19,20)14-7-5-12(6-8-14)11-17-15(18)4-2-1-3-13-9-10-21-22-13/h5-8,13H,1-4,9-11H2,(H,17,18)(H2,16,19,20)/t13-/m1/s1 |
| InChIKey | UONDCGYCXKQFPL-CYBMUJFWSA-N |
| XLogP | 2.66 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|