C16H24N2O3S — CID 2431253
3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide (PubChem CID 2431253) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 2431253 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-cyclohexyl-N-[(4-sulfamoylphenyl)methyl]propanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O3S/c17-22(20,21)15-9-6-14(7-10-15)12-18-16(19)11-8-13-4-2-1-3-5-13/h6-7,9-10,13H,1-5,8,11-12H2,(H,18,19)(H2,17,20,21) |
| InChIKey | MJWBBCSJLXEKAZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |