C14H22N2OS2 — CID 95990301
5-[(3R)-dithiolan-3-yl]-N-[(1-methylpyrrol-2-yl)methyl]pentanamide (PubChem CID 95990301) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-[(1-methylpyrrol-2-yl)methyl]pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-[(1-methylpyrrol-2-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 95990301 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-[(1-methylpyrrol-2-yl)methyl]pentanamide |
| SMILES | Cn1cccc1CNC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C14H22N2OS2/c1-16-9-4-5-12(16)11-15-14(17)7-3-2-6-13-8-10-18-19-13/h4-5,9,13H,2-3,6-8,10-11H2,1H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | XWJRNXXXTNIWMG-CYBMUJFWSA-N |
| XLogP | 3.36 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|