C16H31NO5S2 — CID 91757887
5-(dithiolan-3-yl)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pentanamide (PubChem CID 91757887) has the molecular formula C16H31NO5S2 and a molecular weight of 381.56 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
|---|---|
| PubChem CID | 91757887 |
| Molecular Formula | C16H31NO5S2 |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]pentanamide |
| SMILES | O=C(CCCCC1CCSS1)NCCOCCOCCOCCO |
| InChI | InChI=1S/C16H31NO5S2/c18-7-9-21-11-13-22-12-10-20-8-6-17-16(19)4-2-1-3-15-5-14-23-24-15/h15,18H,1-14H2,(H,17,19) |
| InChIKey | RCNNKKYGPYWQAT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|