C10H19NO3S2 — CID 171562314
5-[(3R)-dithiolan-3-yl]-N-(2-hydroxyethoxy)pentanamide (PubChem CID 171562314) has the molecular formula C10H19NO3S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-(2-hydroxyethoxy)pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-(2-hydroxyethoxy)pentanamide |
|---|---|
| PubChem CID | 171562314 |
| Molecular Formula | C10H19NO3S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-(2-hydroxyethoxy)pentanamide |
| SMILES | O=C(CCCC[C@@H]1CCSS1)NOCCO |
| InChI | InChI=1S/C10H19NO3S2/c12-6-7-14-11-10(13)4-2-1-3-9-5-8-15-16-9/h9,12H,1-8H2,(H,11,13)/t9-/m1/s1 |
| InChIKey | JIAUDEGXXONHHI-SECBINFHSA-N |
| XLogP | 1.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|