C27H46N2O10S2 — CID 160697150
2-[2-[[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]-4-oxobutanoyl]amino]ethoxy]ethyl 7-(2-hydroxyethoxy)-4-oxoheptanoate (PubChem CID 160697150) has the molecular formula C27H46N2O10S2 and a molecular weight of 622.80 g/mol. Its IUPAC name is 2-[2-[[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]-4-oxobutanoyl]amino]ethoxy]ethyl 7-(2-hydroxyethoxy)-4-oxoheptanoate.
| Compound Name | 2-[2-[[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]-4-oxobutanoyl]amino]ethoxy]ethyl 7-(2-hydroxyethoxy)-4-oxoheptanoate |
|---|---|
| PubChem CID | 160697150 |
| Molecular Formula | C27H46N2O10S2 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | 2-[2-[[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethoxy]-4-oxobutanoyl]amino]ethoxy]ethyl 7-(2-hydroxyethoxy)-4-oxoheptanoate |
| SMILES | O=C(CCCOCCO)CCC(=O)OCCOCCNC(=O)CCC(=O)OCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C27H46N2O10S2/c30-14-18-36-15-3-4-22(31)7-9-26(34)39-20-19-37-16-12-28-25(33)8-10-27(35)38-17-13-29-24(32)6-2-1-5-23-11-21-40-41-23/h23,30H,1-21H2,(H,28,33)(H,29,32) |
| InChIKey | NDDNEXRUFCMJAE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|