C28H41N3O10S2 — CID 135299237
2-[5-(dithiolan-3-yl)pentanoylamino]ethyl 4-[2-[2-[2-[2-(4-nitrophenyl)acetyl]oxyethoxy]ethoxy]ethylamino]-4-oxobutanoate (PubChem CID 135299237) has the molecular formula C28H41N3O10S2 and a molecular weight of 643.78 g/mol. Its IUPAC name is 2-[5-(dithiolan-3-yl)pentanoylamino]ethyl 4-[2-[2-[2-[2-(4-nitrophenyl)acetyl]oxyethoxy]ethoxy]ethylamino]-4-oxobutanoate.
| Compound Name | 2-[5-(dithiolan-3-yl)pentanoylamino]ethyl 4-[2-[2-[2-[2-(4-nitrophenyl)acetyl]oxyethoxy]ethoxy]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 135299237 |
| Molecular Formula | C28H41N3O10S2 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | 2-[5-(dithiolan-3-yl)pentanoylamino]ethyl 4-[2-[2-[2-[2-(4-nitrophenyl)acetyl]oxyethoxy]ethoxy]ethylamino]-4-oxobutanoate |
| SMILES | O=C(CCCCC1CCSS1)NCCOC(=O)CCC(=O)NCCOCCOCCOC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H41N3O10S2/c32-25(4-2-1-3-24-11-20-42-43-24)30-13-15-40-27(34)10-9-26(33)29-12-14-38-16-17-39-18-19-41-28(35)21-22-5-7-23(8-6-22)31(36)37/h5-8,24H,1-4,9-21H2,(H,29,33)(H,30,32) |
| InChIKey | YVGFXEWUBMGJHQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|