C17H22N2O6S2 — CID 135299229
2-[5-(dithiolan-3-yl)pentanoylamino]ethyl (4-nitrophenyl) carbonate (PubChem CID 135299229) has the molecular formula C17H22N2O6S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[5-(dithiolan-3-yl)pentanoylamino]ethyl (4-nitrophenyl) carbonate.
| Compound Name | 2-[5-(dithiolan-3-yl)pentanoylamino]ethyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 135299229 |
| Molecular Formula | C17H22N2O6S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[5-(dithiolan-3-yl)pentanoylamino]ethyl (4-nitrophenyl) carbonate |
| SMILES | O=C(CCCCC1CCSS1)NCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H22N2O6S2/c20-16(4-2-1-3-15-9-12-26-27-15)18-10-11-24-17(21)25-14-7-5-13(6-8-14)19(22)23/h5-8,15H,1-4,9-12H2,(H,18,20) |
| InChIKey | FWGCCGWXUSZOQY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|