C25H33N3O9S2 — CID 160959942
[5-[[5-[5-(dithiolan-3-yl)pentanoylamino]-4-oxopentanoyl]amino]-4-oxopentyl] (4-nitrophenyl) carbonate (PubChem CID 160959942) has the molecular formula C25H33N3O9S2 and a molecular weight of 583.69 g/mol. Its IUPAC name is [5-[[5-[5-(dithiolan-3-yl)pentanoylamino]-4-oxopentanoyl]amino]-4-oxopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [5-[[5-[5-(dithiolan-3-yl)pentanoylamino]-4-oxopentanoyl]amino]-4-oxopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 160959942 |
| Molecular Formula | C25H33N3O9S2 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | [5-[[5-[5-(dithiolan-3-yl)pentanoylamino]-4-oxopentanoyl]amino]-4-oxopentyl] (4-nitrophenyl) carbonate |
| SMILES | O=C(CCC(=O)NCC(=O)CCCOC(=O)Oc1ccc([N+](=O)[O-])cc1)CNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C25H33N3O9S2/c29-19(4-3-14-36-25(33)37-21-10-7-18(8-11-21)28(34)35)16-27-24(32)12-9-20(30)17-26-23(31)6-2-1-5-22-13-15-38-39-22/h7-8,10-11,22H,1-6,9,12-17H2,(H,26,31)(H,27,32) |
| InChIKey | UUIWLBYIUSBIKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 171.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|