C25H32O6S2 — CID 89122659
2-[2-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 89122659) has the molecular formula C25H32O6S2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[2-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate.
| Compound Name | 2-[2-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate |
|---|---|
| PubChem CID | 89122659 |
| Molecular Formula | C25H32O6S2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 2-[2-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethoxy]ethyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | COc1ccc2cc(CC(=O)OCCOCCOC(=O)CCCCC3CCSS3)ccc2c1 |
| InChI | InChI=1S/C25H32O6S2/c1-28-22-9-8-20-16-19(6-7-21(20)18-22)17-25(27)31-14-12-29-11-13-30-24(26)5-3-2-4-23-10-15-32-33-23/h6-9,16,18,23H,2-5,10-15,17H2,1H3 |
| InChIKey | UXOWITBDLITDQS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|