C16H19ClO3 — CID 67768971
2-chloroethyl 2-(6-methoxynaphthalen-2-yl)acetate;methane (PubChem CID 67768971) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-chloroethyl 2-(6-methoxynaphthalen-2-yl)acetate;methane.
| Compound Name | 2-chloroethyl 2-(6-methoxynaphthalen-2-yl)acetate;methane |
|---|---|
| PubChem CID | 67768971 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-chloroethyl 2-(6-methoxynaphthalen-2-yl)acetate;methane |
| SMILES | C.COc1ccc2cc(CC(=O)OCCCl)ccc2c1 |
| InChI | InChI=1S/C15H15ClO3.CH4/c1-18-14-5-4-12-8-11(2-3-13(12)10-14)9-15(17)19-7-6-16;/h2-5,8,10H,6-7,9H2,1H3;1H4 |
| InChIKey | RRRCHMMLCPPJMD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|