C24H25NO5 — CID 9346946
[2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 2-(3-methoxyphenyl)acetate (PubChem CID 9346946) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is [2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 2-(3-methoxyphenyl)acetate.
| Compound Name | [2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 9346946 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | [2-[(6-methoxynaphthalen-2-yl)methyl-methylamino]-2-oxoethyl] 2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc(CC(=O)OCC(=O)N(C)Cc2ccc3cc(OC)ccc3c2)c1 |
| InChI | InChI=1S/C24H25NO5/c1-25(15-18-7-8-20-14-22(29-3)10-9-19(20)11-18)23(26)16-30-24(27)13-17-5-4-6-21(12-17)28-2/h4-12,14H,13,15-16H2,1-3H3 |
| InChIKey | CQNOALNMJAUSMK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |