About methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate
methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate (PubChem CID 70261477) has the molecular formula C20H26O5
and a molecular weight of 346.42 g/mol. Its IUPAC name is methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate.
Molecular Properties
| Compound Name | methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate |
| PubChem CID | 70261477 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate |
| SMILES | C.CCCC(=O)OC(C)OC(=O)Cc1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C19H22O5.CH4/c1-4-5-18(20)23-13(2)24-19(21)11-14-6-7-16-12-17(22-3)9-8-15(16)10-14;/h6-10,12-13H,4-5,11H2,1-3H3;1H4 |
| InChIKey | YEPJUTGZMAUGPL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate?
The IUPAC name of methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate (CID 70261477) is methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate.
What is the SMILES notation for methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate?
The canonical SMILES for methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate is C.CCCC(=O)OC(C)OC(=O)Cc1ccc2cc(OC)ccc2c1.
What is the InChIKey of methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate?
The InChIKey is YEPJUTGZMAUGPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O5.CH4/c1-4-5-18(20)23-13(2)24-19(21)11-14-6-7-16-12-17(22-3)9-8-15(16)10-14;/h6-10,12-13H,4-5,11H2,1-3H3;1H4.
What are the key properties of methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate?
methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate has a molecular weight of 346.42 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyethyl butanoate is sourced from PubChem (CID 70261477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).