About (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane
(dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane (PubChem CID 88782104) has the molecular formula C30H49NO3
and a molecular weight of 471.73 g/mol. Its IUPAC name is (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane.
Molecular Properties
| Compound Name | (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane |
| PubChem CID | 88782104 |
| Molecular Formula | C30H49NO3 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.37 |
| IUPAC Name | (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane |
| SMILES | C.CCCCCCCCN(CCCCCCCC)OC(=O)Cc1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C29H45NO3.CH4/c1-4-6-8-10-12-14-20-30(21-15-13-11-9-7-5-2)33-29(31)23-25-16-17-27-24-28(32-3)19-18-26(27)22-25;/h16-19,22,24H,4-15,20-21,23H2,1-3H3;1H4 |
| InChIKey | BOHZAGYTHDNGLR-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane?
The IUPAC name of (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane (CID 88782104) is (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane.
What is the SMILES notation for (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane?
The canonical SMILES for (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane is C.CCCCCCCCN(CCCCCCCC)OC(=O)Cc1ccc2cc(OC)ccc2c1.
What is the InChIKey of (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane?
The InChIKey is BOHZAGYTHDNGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H45NO3.CH4/c1-4-6-8-10-12-14-20-30(21-15-13-11-9-7-5-2)33-29(31)23-25-16-17-27-24-28(32-3)19-18-26(27)22-25;/h16-19,22,24H,4-15,20-21,23H2,1-3H3;1H4.
What are the key properties of (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane?
(dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane has a molecular weight of 471.73 g/mol, XLogP of 8.51, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (dioctylamino) 2-(6-methoxynaphthalen-2-yl)acetate;methane is sourced from PubChem (CID 88782104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).