C16H23NO3S2 — CID 92826449
N-(2,4-dimethoxyphenyl)-5-[(3R)-dithiolan-3-yl]pentanamide (PubChem CID 92826449) has the molecular formula C16H23NO3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-5-[(3R)-dithiolan-3-yl]pentanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-5-[(3R)-dithiolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 92826449 |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-5-[(3R)-dithiolan-3-yl]pentanamide |
| SMILES | COc1ccc(NC(=O)CCCC[C@@H]2CCSS2)c(OC)c1 |
| InChI | InChI=1S/C16H23NO3S2/c1-19-12-7-8-14(15(11-12)20-2)17-16(18)6-4-3-5-13-9-10-21-22-13/h7-8,11,13H,3-6,9-10H2,1-2H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | DHHVWOXDMSYKBO-CYBMUJFWSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|