C18H28N2O4 — CID 50969221
N-(2,4-dimethoxyphenyl)-3-[[(1R,2R)-2-hydroxycyclohexyl]methylamino]propanamide (PubChem CID 50969221) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-[[(1R,2R)-2-hydroxycyclohexyl]methylamino]propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-[[(1R,2R)-2-hydroxycyclohexyl]methylamino]propanamide |
|---|---|
| PubChem CID | 50969221 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-[[(1R,2R)-2-hydroxycyclohexyl]methylamino]propanamide |
| SMILES | COc1ccc(NC(=O)CCNC[C@H]2CCCC[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-23-14-7-8-15(17(11-14)24-2)20-18(22)9-10-19-12-13-5-3-4-6-16(13)21/h7-8,11,13,16,19,21H,3-6,9-10,12H2,1-2H3,(H,20,22)/t13-,16-/m1/s1 |
| InChIKey | UMZYZIFRLHLGEP-CZUORRHYSA-N |
| XLogP | 2.17 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|