C15H22N2O4 — CID 50875892
N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]-2-methylpropanamide (PubChem CID 50875892) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]-2-methylpropanamide.
| Compound Name | N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 50875892 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[3-(2,4-dimethoxyanilino)-3-oxopropyl]-2-methylpropanamide |
| SMILES | COc1ccc(NC(=O)CCNC(=O)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-10(2)15(19)16-8-7-14(18)17-12-6-5-11(20-3)9-13(12)21-4/h5-6,9-10H,7-8H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | JYPXTOZIBJGUBP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |