C15H19NO4 — CID 141249882
N-(2,4-dimethoxyphenyl)-4-methyl-3-(oxomethylidene)pentanamide (PubChem CID 141249882) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-methyl-3-(oxomethylidene)pentanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-methyl-3-(oxomethylidene)pentanamide |
|---|---|
| PubChem CID | 141249882 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-methyl-3-(oxomethylidene)pentanamide |
| SMILES | COc1ccc(NC(=O)CC(=C=O)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C15H19NO4/c1-10(2)11(9-17)7-15(18)16-13-6-5-12(19-3)8-14(13)20-4/h5-6,8,10H,7H2,1-4H3,(H,16,18) |
| InChIKey | FKDQUGBHLOJWOL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|