C16H21FN2O2S2 — CID 55546012
N-(3-acetamido-4-fluorophenyl)-5-(dithiolan-3-yl)pentanamide (PubChem CID 55546012) has the molecular formula C16H21FN2O2S2 and a molecular weight of 356.49 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 55546012 |
| Molecular Formula | C16H21FN2O2S2 |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-5-(dithiolan-3-yl)pentanamide |
| SMILES | CC(=O)Nc1cc(NC(=O)CCCCC2CCSS2)ccc1F |
| InChI | InChI=1S/C16H21FN2O2S2/c1-11(20)18-15-10-12(6-7-14(15)17)19-16(21)5-3-2-4-13-8-9-22-23-13/h6-7,10,13H,2-5,8-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | VDNGZBBIIPMTCW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|